C14H19N5O — CID 63276797
(3aR,7aS)-2-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 63276797) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is (3aR,7aS)-2-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aR,7aS)-2-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 63276797 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (3aR,7aS)-2-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | Cc1noc2ncnc(N3C[C@H]4CCC(N)C[C@H]4C3)c12 |
| InChI | InChI=1S/C14H19N5O/c1-8-12-13(16-7-17-14(12)20-18-8)19-5-9-2-3-11(15)4-10(9)6-19/h7,9-11H,2-6,15H2,1H3/t9-,10+,11?/m1/s1 |
| InChIKey | FYOULBSWZKZQLL-JKIOLJMWSA-N |
| XLogP | 1.49 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |