About oxo-bis(2,4,4-trimethylpentoxy)phosphanium
oxo-bis(2,4,4-trimethylpentoxy)phosphanium (PubChem CID 6327683) has the molecular formula C16H34O3P+
and a molecular weight of 305.42 g/mol. Its IUPAC name is oxo-bis(2,4,4-trimethylpentoxy)phosphanium.
Molecular Properties
| Compound Name | oxo-bis(2,4,4-trimethylpentoxy)phosphanium |
| PubChem CID | 6327683 |
| Molecular Formula | C16H34O3P+ |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | oxo-bis(2,4,4-trimethylpentoxy)phosphanium |
| SMILES | CC(CO[P+](=O)OCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C16H34O3P/c1-13(9-15(3,4)5)11-18-20(17)19-12-14(2)10-16(6,7)8/h13-14H,9-12H2,1-8H3/q+1 |
| InChIKey | NXPXJESSNLRKFY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-bis(2,4,4-trimethylpentoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-bis(2,4,4-trimethylpentoxy)phosphanium?
The IUPAC name of oxo-bis(2,4,4-trimethylpentoxy)phosphanium (CID 6327683) is oxo-bis(2,4,4-trimethylpentoxy)phosphanium.
What is the SMILES notation for oxo-bis(2,4,4-trimethylpentoxy)phosphanium?
The canonical SMILES for oxo-bis(2,4,4-trimethylpentoxy)phosphanium is CC(CO[P+](=O)OCC(C)CC(C)(C)C)CC(C)(C)C.
What is the InChIKey of oxo-bis(2,4,4-trimethylpentoxy)phosphanium?
The InChIKey is NXPXJESSNLRKFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3P/c1-13(9-15(3,4)5)11-18-20(17)19-12-14(2)10-16(6,7)8/h13-14H,9-12H2,1-8H3/q+1.
What are the key properties of oxo-bis(2,4,4-trimethylpentoxy)phosphanium?
oxo-bis(2,4,4-trimethylpentoxy)phosphanium has a molecular weight of 305.42 g/mol, XLogP of 5.82, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-bis(2,4,4-trimethylpentoxy)phosphanium is sourced from PubChem (CID 6327683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).