About Tripropylsilane
Tripropylsilane (PubChem CID 6327709) has the molecular formula C9H21Si
and a molecular weight of 157.35 g/mol.
Molecular Properties
| Compound Name | Tripropylsilane |
| PubChem CID | 6327709 |
| Molecular Formula | C9H21Si |
| Molecular Weight | 157.35 g/mol |
| Exact Mass | 157.14 |
| IUPAC Name | — |
| SMILES | CCC[Si](CCC)CCC |
| InChI | InChI=1S/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
| InChIKey | MMYRBBZVCDXGHG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Tripropylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tripropylsilane?
The IUPAC name of Tripropylsilane (CID 6327709) is not available.
What is the SMILES notation for Tripropylsilane?
The canonical SMILES for Tripropylsilane is CCC[Si](CCC)CCC.
What is the InChIKey of Tripropylsilane?
The InChIKey is MMYRBBZVCDXGHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3.
What are the key properties of Tripropylsilane?
Tripropylsilane has a molecular weight of 157.35 g/mol, XLogP of 3.71, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Tripropylsilane is sourced from PubChem (CID 6327709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).