About Triethoxysilicon
Triethoxysilicon (PubChem CID 6327710) has the molecular formula C6H15O3Si
and a molecular weight of 163.27 g/mol.
Molecular Properties
| Compound Name | Triethoxysilicon |
| PubChem CID | 6327710 |
| Molecular Formula | C6H15O3Si |
| Molecular Weight | 163.27 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)OCC |
| InChI | InChI=1S/C6H15O3Si/c1-4-7-10(8-5-2)9-6-3/h4-6H2,1-3H3 |
| InChIKey | PKDCQJMRWCHQOH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Triethoxysilicon with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triethoxysilicon?
The IUPAC name of Triethoxysilicon (CID 6327710) is not available.
What is the SMILES notation for Triethoxysilicon?
The canonical SMILES for Triethoxysilicon is CCO[Si](OCC)OCC.
What is the InChIKey of Triethoxysilicon?
The InChIKey is PKDCQJMRWCHQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15O3Si/c1-4-7-10(8-5-2)9-6-3/h4-6H2,1-3H3.
What are the key properties of Triethoxysilicon?
Triethoxysilicon has a molecular weight of 163.27 g/mol, XLogP of 1.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Triethoxysilicon is sourced from PubChem (CID 6327710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).