About Tributylsilane
Tributylsilane (PubChem CID 6327711) has the molecular formula C12H27Si
and a molecular weight of 199.43 g/mol.
Molecular Properties
| Compound Name | Tributylsilane |
| PubChem CID | 6327711 |
| Molecular Formula | C12H27Si |
| Molecular Weight | 199.43 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | — |
| SMILES | CCCC[Si](CCCC)CCCC |
| InChI | InChI=1S/C12H27Si/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3 |
| InChIKey | ISEIIPDWJVGTQS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Tributylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tributylsilane?
The IUPAC name of Tributylsilane (CID 6327711) is not available.
What is the SMILES notation for Tributylsilane?
The canonical SMILES for Tributylsilane is CCCC[Si](CCCC)CCCC.
What is the InChIKey of Tributylsilane?
The InChIKey is ISEIIPDWJVGTQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27Si/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3.
What are the key properties of Tributylsilane?
Tributylsilane has a molecular weight of 199.43 g/mol, XLogP of 4.88, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Tributylsilane is sourced from PubChem (CID 6327711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).