About 3,7,10-Trimethylsilatrane, d
3,7,10-Trimethylsilatrane, d (PubChem CID 6327713) has the molecular formula C9H18NO3Si
and a molecular weight of 216.33 g/mol.
Molecular Properties
| Compound Name | 3,7,10-Trimethylsilatrane, d |
| PubChem CID | 6327713 |
| Molecular Formula | C9H18NO3Si |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | — |
| SMILES | CC1CN2CC(C)O[Si](O1)OC(C)C2 |
| InChI | InChI=1S/C9H18NO3Si/c1-7-4-10-5-8(2)12-14(11-7)13-9(3)6-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | LMNREWMBYPSHEZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,7,10-Trimethylsilatrane, d with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7,10-Trimethylsilatrane, d?
The IUPAC name of 3,7,10-Trimethylsilatrane, d (CID 6327713) is not available.
What is the SMILES notation for 3,7,10-Trimethylsilatrane, d?
The canonical SMILES for 3,7,10-Trimethylsilatrane, d is CC1CN2CC(C)O[Si](O1)OC(C)C2.
What is the InChIKey of 3,7,10-Trimethylsilatrane, d?
The InChIKey is LMNREWMBYPSHEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO3Si/c1-7-4-10-5-8(2)12-14(11-7)13-9(3)6-10/h7-9H,4-6H2,1-3H3.
What are the key properties of 3,7,10-Trimethylsilatrane, d?
3,7,10-Trimethylsilatrane, d has a molecular weight of 216.33 g/mol, XLogP of 0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7,10-Trimethylsilatrane, d is sourced from PubChem (CID 6327713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).