About 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid
2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid (PubChem CID 63277329) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid.
Analyze 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid?
The IUPAC name of 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid (CID 63277329) is 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid.
What is the SMILES notation for 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid?
The canonical SMILES for 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid is O=C(O)CN1N=C2CCCCC2C1=O.
What is the InChIKey of 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid?
The InChIKey is FTXILQPIOYWDNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c12-8(13)5-11-9(14)6-3-1-2-4-7(6)10-11/h6H,1-5H2,(H,12,13).
What are the key properties of 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid?
2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid has a molecular weight of 196.21 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-4,5,6,7-tetrahydro-3aH-indazol-2-yl)acetic acid is sourced from PubChem (CID 63277329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).