About 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne
4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne (PubChem CID 6327733) has the molecular formula C16H29OSi
and a molecular weight of 265.49 g/mol.
Molecular Properties
| Compound Name | 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne |
| PubChem CID | 6327733 |
| Molecular Formula | C16H29OSi |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | — |
| SMILES | C=C(C)C#CC(CC(C)C)O[Si](C(C)C)C(C)C |
| InChI | InChI=1S/C16H29OSi/c1-12(2)9-10-16(11-13(3)4)17-18(14(5)6)15(7)8/h13-16H,1,11H2,2-8H3 |
| InChIKey | QGCQAGGDXUPBAU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne?
The IUPAC name of 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne (CID 6327733) is not available.
What is the SMILES notation for 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne?
The canonical SMILES for 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne is C=C(C)C#CC(CC(C)C)O[Si](C(C)C)C(C)C.
What is the InChIKey of 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne?
The InChIKey is QGCQAGGDXUPBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29OSi/c1-12(2)9-10-16(11-13(3)4)17-18(14(5)6)15(7)8/h13-16H,1,11H2,2-8H3.
What are the key properties of 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne?
4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne has a molecular weight of 265.49 g/mol, XLogP of 4.81, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Diisopropylsilyloxy-2,7-dimethyloct-7-en-5-yne is sourced from PubChem (CID 6327733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).