C15H14N4O2 — CID 63277343
3-[[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]benzamide (PubChem CID 63277343) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-[[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]benzamide.
| Compound Name | 3-[[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 63277343 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNc2ccc3[nH]c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C15H14N4O2/c16-14(20)10-3-1-2-9(6-10)8-17-11-4-5-12-13(7-11)19-15(21)18-12/h1-7,17H,8H2,(H2,16,20)(H2,18,19,21) |
| InChIKey | VDDRPKRTDOFISA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|