About 2-Selenouracil
2-Selenouracil (PubChem CID 6327781) has the molecular formula C4H3N2OSe
and a molecular weight of 174.04 g/mol.
Molecular Properties
| Compound Name | 2-Selenouracil |
| PubChem CID | 6327781 |
| Molecular Formula | C4H3N2OSe |
| Molecular Weight | 174.04 g/mol |
| Exact Mass | 174.94 |
| IUPAC Name | — |
| SMILES | O=c1ccnc([Se])[nH]1 |
| InChI | InChI=1S/C4H3N2OSe/c7-3-1-2-5-4(8)6-3/h1-2H,(H,5,6,7) |
| InChIKey | DORROJBNUAGYSZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.04 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-Selenouracil with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Selenouracil?
The IUPAC name of 2-Selenouracil (CID 6327781) is not available.
What is the SMILES notation for 2-Selenouracil?
The canonical SMILES for 2-Selenouracil is O=c1ccnc([Se])[nH]1.
What is the InChIKey of 2-Selenouracil?
The InChIKey is DORROJBNUAGYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N2OSe/c7-3-1-2-5-4(8)6-3/h1-2H,(H,5,6,7).
What are the key properties of 2-Selenouracil?
2-Selenouracil has a molecular weight of 174.04 g/mol, XLogP of -1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Selenouracil is sourced from PubChem (CID 6327781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).