About Hexabutyldistannane
Hexabutyldistannane (PubChem CID 6327815) has the molecular formula C24H54Sn2
and a molecular weight of 580.12 g/mol.
Molecular Properties
| Compound Name | Hexabutyldistannane |
| PubChem CID | 6327815 |
| Molecular Formula | C24H54Sn2 |
| Molecular Weight | 580.12 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | — |
| SMILES | CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC |
| InChI | InChI=1S/6C4H9.2Sn/c6*1-3-4-2;;/h6*1,3-4H2,2H3;; |
| InChIKey | REDSKZBUUUQMSK-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.12 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Hexabutyldistannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hexabutyldistannane?
The IUPAC name of Hexabutyldistannane (CID 6327815) is not available.
What is the SMILES notation for Hexabutyldistannane?
The canonical SMILES for Hexabutyldistannane is CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC.
What is the InChIKey of Hexabutyldistannane?
The InChIKey is REDSKZBUUUQMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/6C4H9.2Sn/c6*1-3-4-2;;/h6*1,3-4H2,2H3;;.
What are the key properties of Hexabutyldistannane?
Hexabutyldistannane has a molecular weight of 580.12 g/mol, XLogP of 9.76, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Hexabutyldistannane is sourced from PubChem (CID 6327815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).