About Tri-n-butylgermane
Tri-n-butylgermane (PubChem CID 6327830) has the molecular formula C12H27Ge
and a molecular weight of 243.96 g/mol.
Molecular Properties
| Compound Name | Tri-n-butylgermane |
| PubChem CID | 6327830 |
| Molecular Formula | C12H27Ge |
| Molecular Weight | 243.96 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | — |
| SMILES | CCCC[Ge](CCCC)CCCC |
| InChI | InChI=1S/C12H27Ge/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3 |
| InChIKey | UMRPCNGKANTZSN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.96 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Tri-n-butylgermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tri-n-butylgermane?
The IUPAC name of Tri-n-butylgermane (CID 6327830) is not available.
What is the SMILES notation for Tri-n-butylgermane?
The canonical SMILES for Tri-n-butylgermane is CCCC[Ge](CCCC)CCCC.
What is the InChIKey of Tri-n-butylgermane?
The InChIKey is UMRPCNGKANTZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27Ge/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3.
What are the key properties of Tri-n-butylgermane?
Tri-n-butylgermane has a molecular weight of 243.96 g/mol, XLogP of 4.88, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Tri-n-butylgermane is sourced from PubChem (CID 6327830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).