About 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one
1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 63279867) has the molecular formula C11H8ClF3N2OS
and a molecular weight of 308.71 g/mol. Its IUPAC name is 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 63279867 |
| Molecular Formula | C11H8ClF3N2OS |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1ccc(C(F)(F)F)cn1Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H8ClF3N2OS/c12-3-8-6-19-9(16-8)5-17-4-7(11(13,14)15)1-2-10(17)18/h1-2,4,6H,3,5H2 |
| InChIKey | ZOJNRRMBTCPVAN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one (CID 63279867) is 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one is O=c1ccc(C(F)(F)F)cn1Cc1nc(CCl)cs1.
What is the InChIKey of 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is ZOJNRRMBTCPVAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClF3N2OS/c12-3-8-6-19-9(16-8)5-17-4-7(11(13,14)15)1-2-10(17)18/h1-2,4,6H,3,5H2.
What are the key properties of 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one?
1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 308.71 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 63279867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).