About 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one
1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 63280039) has the molecular formula C12H7Cl2F3N2O
and a molecular weight of 323.10 g/mol. Its IUPAC name is 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 63280039 |
| Molecular Formula | C12H7Cl2F3N2O |
| Molecular Weight | 323.10 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1ccc(C(F)(F)F)cn1Cc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H7Cl2F3N2O/c13-8-2-3-10(14)18-9(8)6-19-5-7(12(15,16)17)1-4-11(19)20/h1-5H,6H2 |
| InChIKey | YSCLTJINENOUMT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.10 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one (CID 63280039) is 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one is O=c1ccc(C(F)(F)F)cn1Cc1nc(Cl)ccc1Cl.
What is the InChIKey of 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is YSCLTJINENOUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2F3N2O/c13-8-2-3-10(14)18-9(8)6-19-5-7(12(15,16)17)1-4-11(19)20/h1-5H,6H2.
What are the key properties of 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one?
1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 323.10 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,6-dichloro-2-pyridinyl)methyl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 63280039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).