About 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid
4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid (PubChem CID 63280743) has the molecular formula C9H12N2O3S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid.
Analyze 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid?
The IUPAC name of 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid (CID 63280743) is 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid?
The canonical SMILES for 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid is Cc1ncsc1CNC(=O)CCC(=O)O.
What is the InChIKey of 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid?
The InChIKey is NXYRTQZLLLLNMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c1-6-7(15-5-11-6)4-10-8(12)2-3-9(13)14/h5H,2-4H2,1H3,(H,10,12)(H,13,14).
What are the key properties of 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid?
4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid has a molecular weight of 228.27 g/mol, XLogP of 0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methyl-1,3-thiazol-5-yl)methylamino]-4-oxobutanoic acid is sourced from PubChem (CID 63280743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).