About Sodium carboxymethyl cellulose
Sodium carboxymethyl cellulose (PubChem CID 6328154) has the molecular formula C8H16NaO8
and a molecular weight of 263.20 g/mol.
Molecular Properties
| Compound Name | Sodium carboxymethyl cellulose |
| PubChem CID | 6328154 |
| Molecular Formula | C8H16NaO8 |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | — |
| SMILES | CC(=O)O.O=CC(O)C(O)C(O)C(O)CO.[Na] |
| InChI | InChI=1S/C6H12O6.C2H4O2.Na/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4;/h1,3-6,8-12H,2H2;1H3,(H,3,4); |
| InChIKey | DPXJVFZANSGRMM-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze Sodium carboxymethyl cellulose with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sodium carboxymethyl cellulose?
The IUPAC name of Sodium carboxymethyl cellulose (CID 6328154) is not available.
What is the SMILES notation for Sodium carboxymethyl cellulose?
The canonical SMILES for Sodium carboxymethyl cellulose is CC(=O)O.O=CC(O)C(O)C(O)C(O)CO.[Na].
What is the InChIKey of Sodium carboxymethyl cellulose?
The InChIKey is DPXJVFZANSGRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6.C2H4O2.Na/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4;/h1,3-6,8-12H,2H2;1H3,(H,3,4);.
What are the key properties of Sodium carboxymethyl cellulose?
Sodium carboxymethyl cellulose has a molecular weight of 263.20 g/mol, XLogP of -3.67, 5 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Sodium carboxymethyl cellulose is sourced from PubChem (CID 6328154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).