C20H12B2O6 — CID 632832
2,7-diphenyl-[1,3,2]dioxaborinino[4,5-g][1,3,2]benzodioxaborinine-4,9-dione (PubChem CID 632832) has the molecular formula C20H12B2O6 and a molecular weight of 369.93 g/mol. Its IUPAC name is 2,7-diphenyl-[1,3,2]dioxaborinino[4,5-g][1,3,2]benzodioxaborinine-4,9-dione.
| Compound Name | 2,7-diphenyl-[1,3,2]dioxaborinino[4,5-g][1,3,2]benzodioxaborinine-4,9-dione |
|---|---|
| PubChem CID | 632832 |
| Molecular Formula | C20H12B2O6 |
| Molecular Weight | 369.93 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2,7-diphenyl-[1,3,2]dioxaborinino[4,5-g][1,3,2]benzodioxaborinine-4,9-dione |
| SMILES | O=C1OB(c2ccccc2)Oc2cc3c(cc21)OB(c1ccccc1)OC3=O |
| InChI | InChI=1S/C20H12B2O6/c23-19-15-12-18-16(20(24)28-22(26-18)14-9-5-2-6-10-14)11-17(15)25-21(27-19)13-7-3-1-4-8-13/h1-12H |
| InChIKey | OXIVJXKYVIZFBK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.93 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|