About 2-Selenoethylguanidine
2-Selenoethylguanidine (PubChem CID 6328329) has the molecular formula C3H8N3Se
and a molecular weight of 165.08 g/mol.
Molecular Properties
| Compound Name | 2-Selenoethylguanidine |
| PubChem CID | 6328329 |
| Molecular Formula | C3H8N3Se |
| Molecular Weight | 165.08 g/mol |
| Exact Mass | 165.99 |
| IUPAC Name | — |
| SMILES | NC(N)=NCC[Se] |
| InChI | InChI=1S/C3H8N3Se/c4-3(5)6-1-2-7/h1-2H2,(H4,4,5,6) |
| InChIKey | DWZMJBJNZNXIRF-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.08 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-Selenoethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Selenoethylguanidine?
The IUPAC name of 2-Selenoethylguanidine (CID 6328329) is not available.
What is the SMILES notation for 2-Selenoethylguanidine?
The canonical SMILES for 2-Selenoethylguanidine is NC(N)=NCC[Se].
What is the InChIKey of 2-Selenoethylguanidine?
The InChIKey is DWZMJBJNZNXIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N3Se/c4-3(5)6-1-2-7/h1-2H2,(H4,4,5,6).
What are the key properties of 2-Selenoethylguanidine?
2-Selenoethylguanidine has a molecular weight of 165.08 g/mol, XLogP of -1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Selenoethylguanidine is sourced from PubChem (CID 6328329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).