About N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide
N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide (PubChem CID 63283564) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide.
Molecular Properties
| Compound Name | N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide |
| PubChem CID | 63283564 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide |
| SMILES | CCC/C(N)=N\Cc1scnc1C |
| InChI | InChI=1S/C9H15N3S/c1-3-4-9(10)11-5-8-7(2)12-6-13-8/h6H,3-5H2,1-2H3,(H2,10,11) |
| InChIKey | BWLXOJSVHCGGRR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide?
The IUPAC name of N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide (CID 63283564) is N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide.
What is the SMILES notation for N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide?
The canonical SMILES for N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide is CCC/C(N)=N\Cc1scnc1C.
What is the InChIKey of N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide?
The InChIKey is BWLXOJSVHCGGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c1-3-4-9(10)11-5-8-7(2)12-6-13-8/h6H,3-5H2,1-2H3,(H2,10,11).
What are the key properties of N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide?
N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide has a molecular weight of 197.31 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide is sourced from PubChem (CID 63283564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).