About bis(dihydroxy(oxo)phosphanium);technetium-99
bis(dihydroxy(oxo)phosphanium);technetium-99 (PubChem CID 6328361) has the molecular formula H4O6P2Tc+2
and a molecular weight of 260.88 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);technetium-99.
Molecular Properties
| Compound Name | bis(dihydroxy(oxo)phosphanium);technetium-99 |
| PubChem CID | 6328361 |
| Molecular Formula | H4O6P2Tc+2 |
| Molecular Weight | 260.88 g/mol |
| Exact Mass | 260.85 |
| IUPAC Name | bis(dihydroxy(oxo)phosphanium);technetium-99 |
| SMILES | O=[P+](O)O.O=[P+](O)O.[99Tc] |
| InChI | InChI=1S/2HO3P.Tc/c2*1-4(2)3;/h2*(H-,1,2,3);/p+2/i;;1+1 |
| InChIKey | HVUPAIPGDGGJEH-FCHARDOESA-P |
| XLogP | -0.75 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.88 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dihydroxy(oxo)phosphanium);technetium-99 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dihydroxy(oxo)phosphanium);technetium-99?
The IUPAC name of bis(dihydroxy(oxo)phosphanium);technetium-99 (CID 6328361) is bis(dihydroxy(oxo)phosphanium);technetium-99.
What is the SMILES notation for bis(dihydroxy(oxo)phosphanium);technetium-99?
The canonical SMILES for bis(dihydroxy(oxo)phosphanium);technetium-99 is O=[P+](O)O.O=[P+](O)O.[99Tc].
What is the InChIKey of bis(dihydroxy(oxo)phosphanium);technetium-99?
The InChIKey is HVUPAIPGDGGJEH-FCHARDOESA-P. The full InChI is InChI=1S/2HO3P.Tc/c2*1-4(2)3;/h2*(H-,1,2,3);/p+2/i;;1+1.
What are the key properties of bis(dihydroxy(oxo)phosphanium);technetium-99?
bis(dihydroxy(oxo)phosphanium);technetium-99 has a molecular weight of 260.88 g/mol, XLogP of -0.75, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihydroxy(oxo)phosphanium);technetium-99 is sourced from PubChem (CID 6328361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).