C12H11N3O4S — CID 63283620
5-[(4-methyl-1,3-thiazol-5-yl)methylamino]-2-nitrobenzoic acid (PubChem CID 63283620) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is 5-[(4-methyl-1,3-thiazol-5-yl)methylamino]-2-nitrobenzoic acid.
| Compound Name | 5-[(4-methyl-1,3-thiazol-5-yl)methylamino]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 63283620 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-[(4-methyl-1,3-thiazol-5-yl)methylamino]-2-nitrobenzoic acid |
| SMILES | Cc1ncsc1CNc1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C12H11N3O4S/c1-7-11(20-6-14-7)5-13-8-2-3-10(15(18)19)9(4-8)12(16)17/h2-4,6,13H,5H2,1H3,(H,16,17) |
| InChIKey | WDPHLMMMECPQHE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|