C15H20N2O — CID 63284353
N-(4-cyanobutyl)-3-(4-methylphenyl)propanamide (PubChem CID 63284353) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-(4-cyanobutyl)-3-(4-methylphenyl)propanamide.
| Compound Name | N-(4-cyanobutyl)-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 63284353 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-(4-cyanobutyl)-3-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)NCCCCC#N)cc1 |
| InChI | InChI=1S/C15H20N2O/c1-13-5-7-14(8-6-13)9-10-15(18)17-12-4-2-3-11-16/h5-8H,2-4,9-10,12H2,1H3,(H,17,18) |
| InChIKey | UYOYRDQUCHYRCH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|