About methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate
methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate (PubChem CID 63285080) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate.
Molecular Properties
| Compound Name | methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate |
| PubChem CID | 63285080 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate |
| SMILES | COCCN(CCC#N)CCCC(=O)OC |
| InChI | InChI=1S/C11H20N2O3/c1-15-10-9-13(8-4-6-12)7-3-5-11(14)16-2/h3-5,7-10H2,1-2H3 |
| InChIKey | KLSOKLYJDXACQP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate?
The IUPAC name of methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate (CID 63285080) is methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate.
What is the SMILES notation for methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate?
The canonical SMILES for methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate is COCCN(CCC#N)CCCC(=O)OC.
What is the InChIKey of methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate?
The InChIKey is KLSOKLYJDXACQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-15-10-9-13(8-4-6-12)7-3-5-11(14)16-2/h3-5,7-10H2,1-2H3.
What are the key properties of methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate?
methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate has a molecular weight of 228.29 g/mol, XLogP of 0.80, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-cyanoethyl(2-methoxyethyl)amino]butanoate is sourced from PubChem (CID 63285080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).