About Dimethylethoxysilane
Dimethylethoxysilane (PubChem CID 6328550) has the molecular formula C4H11OSi
and a molecular weight of 103.22 g/mol.
Molecular Properties
| Compound Name | Dimethylethoxysilane |
| PubChem CID | 6328550 |
| Molecular Formula | C4H11OSi |
| Molecular Weight | 103.22 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | — |
| SMILES | CCO[Si](C)C |
| InChI | InChI=1S/C4H11OSi/c1-4-5-6(2)3/h4H2,1-3H3 |
| InChIKey | DRUOQOFQRYFQGB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Dimethylethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dimethylethoxysilane?
The IUPAC name of Dimethylethoxysilane (CID 6328550) is not available.
What is the SMILES notation for Dimethylethoxysilane?
The canonical SMILES for Dimethylethoxysilane is CCO[Si](C)C.
What is the InChIKey of Dimethylethoxysilane?
The InChIKey is DRUOQOFQRYFQGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11OSi/c1-4-5-6(2)3/h4H2,1-3H3.
What are the key properties of Dimethylethoxysilane?
Dimethylethoxysilane has a molecular weight of 103.22 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Dimethylethoxysilane is sourced from PubChem (CID 6328550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).