About 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide
3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide (PubChem CID 63286081) has the molecular formula C15H26N4O2
and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide.
Molecular Properties
| Compound Name | 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide |
| PubChem CID | 63286081 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CCOC)Cc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C15H26N4O2/c1-11-9-18-13(12(2)15(11)21-4)10-19(7-8-20-3)6-5-14(16)17/h9H,5-8,10H2,1-4H3,(H3,16,17) |
| InChIKey | ISZQYFKHLPAITF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide?
The IUPAC name of 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide (CID 63286081) is 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide.
What is the SMILES notation for 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide?
The canonical SMILES for 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide is [H]/N=C(\N)CCN(CCOC)Cc1ncc(C)c(OC)c1C.
What is the InChIKey of 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide?
The InChIKey is ISZQYFKHLPAITF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O2/c1-11-9-18-13(12(2)15(11)21-4)10-19(7-8-20-3)6-5-14(16)17/h9H,5-8,10H2,1-4H3,(H3,16,17).
What are the key properties of 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide?
3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide has a molecular weight of 294.40 g/mol, XLogP of 1.48, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl-(2-methoxyethyl)amino]propanimidamide is sourced from PubChem (CID 63286081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).