About N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine
N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine (PubChem CID 63287337) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine |
| PubChem CID | 63287337 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine |
| SMILES | COCCN(CCCN)c1ncccn1 |
| InChI | InChI=1S/C10H18N4O/c1-15-9-8-14(7-2-4-11)10-12-5-3-6-13-10/h3,5-6H,2,4,7-9,11H2,1H3 |
| InChIKey | KTUBAXJPIZNNBM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine?
The IUPAC name of N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine (CID 63287337) is N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine.
What is the SMILES notation for N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine?
The canonical SMILES for N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine is COCCN(CCCN)c1ncccn1.
What is the InChIKey of N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine?
The InChIKey is KTUBAXJPIZNNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c1-15-9-8-14(7-2-4-11)10-12-5-3-6-13-10/h3,5-6H,2,4,7-9,11H2,1H3.
What are the key properties of N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine?
N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine has a molecular weight of 210.28 g/mol, XLogP of 0.28, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine is sourced from PubChem (CID 63287337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).