C7H21O2Si3 — CID 6328734
1,1,1,3,3,5,5-Heptamethyltrisiloxane (PubChem CID 6328734) has the molecular formula C7H21O2Si3 and a molecular weight of 221.50 g/mol.
| Compound Name | 1,1,1,3,3,5,5-Heptamethyltrisiloxane |
|---|---|
| PubChem CID | 6328734 |
| Molecular Formula | C7H21O2Si3 |
| Molecular Weight | 221.50 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C7H21O2Si3/c1-10(2)8-12(6,7)9-11(3,4)5/h1-7H3 |
| InChIKey | GDDVTIGTERZVBW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|