About Triphenylplumbanol
Triphenylplumbanol (PubChem CID 6328765) has the molecular formula C18H17OPb
and a molecular weight of 456.53 g/mol.
Molecular Properties
| Compound Name | Triphenylplumbanol |
| PubChem CID | 6328765 |
| Molecular Formula | C18H17OPb |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | — |
| SMILES | O.c1ccc([Pb](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.H2O.Pb/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H2; |
| InChIKey | NVXIRLZJUXDBQO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Triphenylplumbanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triphenylplumbanol?
The IUPAC name of Triphenylplumbanol (CID 6328765) is not available.
What is the SMILES notation for Triphenylplumbanol?
The canonical SMILES for Triphenylplumbanol is O.c1ccc([Pb](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of Triphenylplumbanol?
The InChIKey is NVXIRLZJUXDBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.H2O.Pb/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H2;.
What are the key properties of Triphenylplumbanol?
Triphenylplumbanol has a molecular weight of 456.53 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triphenylplumbanol is sourced from PubChem (CID 6328765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).