About N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine
N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine (PubChem CID 63287766) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine |
| PubChem CID | 63287766 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine |
| SMILES | COCCN(CCCN)Cc1ccncc1 |
| InChI | InChI=1S/C12H21N3O/c1-16-10-9-15(8-2-5-13)11-12-3-6-14-7-4-12/h3-4,6-7H,2,5,8-11,13H2,1H3 |
| InChIKey | WLKDUHLEGQVZDA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine?
The IUPAC name of N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine (CID 63287766) is N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine is COCCN(CCCN)Cc1ccncc1.
What is the InChIKey of N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine?
The InChIKey is WLKDUHLEGQVZDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O/c1-16-10-9-15(8-2-5-13)11-12-3-6-14-7-4-12/h3-4,6-7H,2,5,8-11,13H2,1H3.
What are the key properties of N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine?
N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine has a molecular weight of 223.32 g/mol, XLogP of 0.88, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyethyl)-N'-(pyridin-4-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 63287766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).