C13H21NO5S2 — CID 63287811
ethyl 2-(3-methoxypropylsulfonylamino)-4,5-dimethylthiophene-3-carboxylate (PubChem CID 63287811) has the molecular formula C13H21NO5S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is ethyl 2-(3-methoxypropylsulfonylamino)-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(3-methoxypropylsulfonylamino)-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 63287811 |
| Molecular Formula | C13H21NO5S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | ethyl 2-(3-methoxypropylsulfonylamino)-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NS(=O)(=O)CCCOC)sc(C)c1C |
| InChI | InChI=1S/C13H21NO5S2/c1-5-19-13(15)11-9(2)10(3)20-12(11)14-21(16,17)8-6-7-18-4/h14H,5-8H2,1-4H3 |
| InChIKey | RDSBGWCMILUWJD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|