About Methyldiallylsilane
Methyldiallylsilane (PubChem CID 6328924) has the molecular formula C7H13Si
and a molecular weight of 125.27 g/mol.
Molecular Properties
| Compound Name | Methyldiallylsilane |
| PubChem CID | 6328924 |
| Molecular Formula | C7H13Si |
| Molecular Weight | 125.27 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | — |
| SMILES | C=CC[Si](C)CC=C |
| InChI | InChI=1S/C7H13Si/c1-4-6-8(3)7-5-2/h4-5H,1-2,6-7H2,3H3 |
| InChIKey | GFHXKPBNCYEKCY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Methyldiallylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyldiallylsilane?
The IUPAC name of Methyldiallylsilane (CID 6328924) is not available.
What is the SMILES notation for Methyldiallylsilane?
The canonical SMILES for Methyldiallylsilane is C=CC[Si](C)CC=C.
What is the InChIKey of Methyldiallylsilane?
The InChIKey is GFHXKPBNCYEKCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Si/c1-4-6-8(3)7-5-2/h4-5H,1-2,6-7H2,3H3.
What are the key properties of Methyldiallylsilane?
Methyldiallylsilane has a molecular weight of 125.27 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Methyldiallylsilane is sourced from PubChem (CID 6328924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).