C16H38O5Si4 — CID 6328986
1,3,5,7-Tetraethyl-1,7-dibutoxytetrasiloxane (PubChem CID 6328986) has the molecular formula C16H38O5Si4 and a molecular weight of 422.82 g/mol.
| Compound Name | 1,3,5,7-Tetraethyl-1,7-dibutoxytetrasiloxane |
|---|---|
| PubChem CID | 6328986 |
| Molecular Formula | C16H38O5Si4 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | — |
| SMILES | CCCCO[Si](CC)O[Si](CC)O[Si](CC)O[Si](CC)OCCCC |
| InChI | InChI=1S/C16H38O5Si4/c1-7-13-15-17-22(9-3)19-24(11-5)21-25(12-6)20-23(10-4)18-16-14-8-2/h7-16H2,1-6H3 |
| InChIKey | HLJPXBXEVCDSMA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|