About Allyldimethylsilane
Allyldimethylsilane (PubChem CID 6329006) has the molecular formula C5H11Si
and a molecular weight of 99.23 g/mol.
Molecular Properties
| Compound Name | Allyldimethylsilane |
| PubChem CID | 6329006 |
| Molecular Formula | C5H11Si |
| Molecular Weight | 99.23 g/mol |
| Exact Mass | 99.06 |
| IUPAC Name | — |
| SMILES | C=CC[Si](C)C |
| InChI | InChI=1S/C5H11Si/c1-4-5-6(2)3/h4H,1,5H2,2-3H3 |
| InChIKey | ZBMGMUODZNQAQI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Allyldimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Allyldimethylsilane?
The IUPAC name of Allyldimethylsilane (CID 6329006) is not available.
What is the SMILES notation for Allyldimethylsilane?
The canonical SMILES for Allyldimethylsilane is C=CC[Si](C)C.
What is the InChIKey of Allyldimethylsilane?
The InChIKey is ZBMGMUODZNQAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11Si/c1-4-5-6(2)3/h4H,1,5H2,2-3H3.
What are the key properties of Allyldimethylsilane?
Allyldimethylsilane has a molecular weight of 99.23 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Allyldimethylsilane is sourced from PubChem (CID 6329006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).