About Silane, (fluoromethyl)dimethyl-
Silane, (fluoromethyl)dimethyl- (PubChem CID 6329007) has the molecular formula C3H8FSi
and a molecular weight of 91.18 g/mol.
Molecular Properties
| Compound Name | Silane, (fluoromethyl)dimethyl- |
|---|
| PubChem CID | 6329007 |
|---|
| Molecular Formula | C3H8FSi |
|---|
| Molecular Weight | 91.18 g/mol |
|---|
| Exact Mass | 91.04 |
|---|
| IUPAC Name | — |
|---|
| SMILES | C[Si](C)CF |
|---|
| InChI | InChI=1S/C3H8FSi/c1-5(2)3-4/h3H2,1-2H3 |
|---|
| InChIKey | CYADTQJMQAVSFA-UHFFFAOYSA-N |
|---|
| XLogP | 1.25 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 5 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 91.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silane, (fluoromethyl)dimethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane, (fluoromethyl)dimethyl-?
The IUPAC name of Silane, (fluoromethyl)dimethyl- (CID 6329007) is not available.
What is the SMILES notation for Silane, (fluoromethyl)dimethyl-?
The canonical SMILES for Silane, (fluoromethyl)dimethyl- is C[Si](C)CF.
What is the InChIKey of Silane, (fluoromethyl)dimethyl-?
The InChIKey is CYADTQJMQAVSFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8FSi/c1-5(2)3-4/h3H2,1-2H3.
What are the key properties of Silane, (fluoromethyl)dimethyl-?
Silane, (fluoromethyl)dimethyl- has a molecular weight of 91.18 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Silane, (fluoromethyl)dimethyl- is sourced from PubChem (CID 6329007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).