About Silane, cyclohexyldiethyl-
Silane, cyclohexyldiethyl- (PubChem CID 6329150) has the molecular formula C10H21Si
and a molecular weight of 169.36 g/mol.
Molecular Properties
| Compound Name | Silane, cyclohexyldiethyl- |
| PubChem CID | 6329150 |
| Molecular Formula | C10H21Si |
| Molecular Weight | 169.36 g/mol |
| Exact Mass | 169.14 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)C1CCCCC1 |
| InChI | InChI=1S/C10H21Si/c1-3-11(4-2)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3 |
| InChIKey | IOQLKVPNFLGJMY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silane, cyclohexyldiethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane, cyclohexyldiethyl-?
The IUPAC name of Silane, cyclohexyldiethyl- (CID 6329150) is not available.
What is the SMILES notation for Silane, cyclohexyldiethyl-?
The canonical SMILES for Silane, cyclohexyldiethyl- is CC[Si](CC)C1CCCCC1.
What is the InChIKey of Silane, cyclohexyldiethyl-?
The InChIKey is IOQLKVPNFLGJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21Si/c1-3-11(4-2)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3.
What are the key properties of Silane, cyclohexyldiethyl-?
Silane, cyclohexyldiethyl- has a molecular weight of 169.36 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Silane, cyclohexyldiethyl- is sourced from PubChem (CID 6329150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).