About Disilane, pentaethyl-
Disilane, pentaethyl- (PubChem CID 6329168) has the molecular formula C10H25Si2
and a molecular weight of 201.48 g/mol.
Molecular Properties
| Compound Name | Disilane, pentaethyl- |
| PubChem CID | 6329168 |
| Molecular Formula | C10H25Si2 |
| Molecular Weight | 201.48 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C10H25Si2/c1-6-11(7-2)12(8-3,9-4)10-5/h6-10H2,1-5H3 |
| InChIKey | SNGGQLLRVBSJNA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Disilane, pentaethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Disilane, pentaethyl-?
The IUPAC name of Disilane, pentaethyl- (CID 6329168) is not available.
What is the SMILES notation for Disilane, pentaethyl-?
The canonical SMILES for Disilane, pentaethyl- is CC[Si](CC)[Si](CC)(CC)CC.
What is the InChIKey of Disilane, pentaethyl-?
The InChIKey is SNGGQLLRVBSJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25Si2/c1-6-11(7-2)12(8-3,9-4)10-5/h6-10H2,1-5H3.
What are the key properties of Disilane, pentaethyl-?
Disilane, pentaethyl- has a molecular weight of 201.48 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Disilane, pentaethyl- is sourced from PubChem (CID 6329168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).