About Diisopropylethoxysilane
Diisopropylethoxysilane (PubChem CID 6329175) has the molecular formula C8H19OSi
and a molecular weight of 159.32 g/mol.
Molecular Properties
| Compound Name | Diisopropylethoxysilane |
| PubChem CID | 6329175 |
| Molecular Formula | C8H19OSi |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.12 |
| IUPAC Name | — |
| SMILES | CCO[Si](C(C)C)C(C)C |
| InChI | InChI=1S/C8H19OSi/c1-6-9-10(7(2)3)8(4)5/h7-8H,6H2,1-5H3 |
| InChIKey | PUNLSJOSQANDRG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Diisopropylethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diisopropylethoxysilane?
The IUPAC name of Diisopropylethoxysilane (CID 6329175) is not available.
What is the SMILES notation for Diisopropylethoxysilane?
The canonical SMILES for Diisopropylethoxysilane is CCO[Si](C(C)C)C(C)C.
What is the InChIKey of Diisopropylethoxysilane?
The InChIKey is PUNLSJOSQANDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19OSi/c1-6-9-10(7(2)3)8(4)5/h7-8H,6H2,1-5H3.
What are the key properties of Diisopropylethoxysilane?
Diisopropylethoxysilane has a molecular weight of 159.32 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Diisopropylethoxysilane is sourced from PubChem (CID 6329175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).