C13H14N2O3S2 — CID 63292054
2-[4-oxo-1-(1-thiophen-2-ylpropan-2-yl)pyrimidin-2-yl]sulfanylacetic acid (PubChem CID 63292054) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[4-oxo-1-(1-thiophen-2-ylpropan-2-yl)pyrimidin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-oxo-1-(1-thiophen-2-ylpropan-2-yl)pyrimidin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 63292054 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[4-oxo-1-(1-thiophen-2-ylpropan-2-yl)pyrimidin-2-yl]sulfanylacetic acid |
| SMILES | CC(Cc1cccs1)n1ccc(=O)nc1SCC(=O)O |
| InChI | InChI=1S/C13H14N2O3S2/c1-9(7-10-3-2-6-19-10)15-5-4-11(16)14-13(15)20-8-12(17)18/h2-6,9H,7-8H2,1H3,(H,17,18) |
| InChIKey | KZPLLIGVNSFMJW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |