About Benzene, (ethenylmethylsilyl)-
Benzene, (ethenylmethylsilyl)- (PubChem CID 6329252) has the molecular formula C9H11Si
and a molecular weight of 147.27 g/mol.
Molecular Properties
| Compound Name | Benzene, (ethenylmethylsilyl)- |
| PubChem CID | 6329252 |
| Molecular Formula | C9H11Si |
| Molecular Weight | 147.27 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | — |
| SMILES | C=C[Si](C)c1ccccc1 |
| InChI | InChI=1S/C9H11Si/c1-3-10(2)9-7-5-4-6-8-9/h3-8H,1H2,2H3 |
| InChIKey | MOSXLDGILGBOSZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Benzene, (ethenylmethylsilyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzene, (ethenylmethylsilyl)-?
The IUPAC name of Benzene, (ethenylmethylsilyl)- (CID 6329252) is not available.
What is the SMILES notation for Benzene, (ethenylmethylsilyl)-?
The canonical SMILES for Benzene, (ethenylmethylsilyl)- is C=C[Si](C)c1ccccc1.
What is the InChIKey of Benzene, (ethenylmethylsilyl)-?
The InChIKey is MOSXLDGILGBOSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Si/c1-3-10(2)9-7-5-4-6-8-9/h3-8H,1H2,2H3.
What are the key properties of Benzene, (ethenylmethylsilyl)-?
Benzene, (ethenylmethylsilyl)- has a molecular weight of 147.27 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Benzene, (ethenylmethylsilyl)- is sourced from PubChem (CID 6329252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).