C12H15FN2S — CID 63292626
2-[[cyclopropyl(methyl)amino]methyl]-5-fluorobenzenecarbothioamide (PubChem CID 63292626) has the molecular formula C12H15FN2S and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[[cyclopropyl(methyl)amino]methyl]-5-fluorobenzenecarbothioamide.
| Compound Name | 2-[[cyclopropyl(methyl)amino]methyl]-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63292626 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-[[cyclopropyl(methyl)amino]methyl]-5-fluorobenzenecarbothioamide |
| SMILES | CN(Cc1ccc(F)cc1C(N)=S)C1CC1 |
| InChI | InChI=1S/C12H15FN2S/c1-15(10-4-5-10)7-8-2-3-9(13)6-11(8)12(14)16/h2-3,6,10H,4-5,7H2,1H3,(H2,14,16) |
| InChIKey | MJHCLEJQAZQAQY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|