C23H16OS2 — CID 632932
4,6,7-triphenyl-2-oxa-1lambda4,8-dithiabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 632932) has the molecular formula C23H16OS2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 4,6,7-triphenyl-2-oxa-1lambda4,8-dithiabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 4,6,7-triphenyl-2-oxa-1lambda4,8-dithiabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 632932 |
| Molecular Formula | C23H16OS2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4,6,7-triphenyl-2-oxa-1lambda4,8-dithiabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | C1=C(c2ccccc2)C2=S(O1)SC(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C23H16OS2/c1-4-10-17(11-5-1)20-16-24-26-23(20)21(18-12-6-2-7-13-18)22(25-26)19-14-8-3-9-15-19/h1-16H |
| InChIKey | DAWYUACWUIVXFI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|