C11H21NO2 — CID 63294520
N-(2-cyclopropyl-2-hydroxyethyl)-2-ethylbutanamide (PubChem CID 63294520) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxyethyl)-2-ethylbutanamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxyethyl)-2-ethylbutanamide |
|---|---|
| PubChem CID | 63294520 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxyethyl)-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCC(O)C1CC1 |
| InChI | InChI=1S/C11H21NO2/c1-3-8(4-2)11(14)12-7-10(13)9-5-6-9/h8-10,13H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | DKROJYOEDYTHKG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |