About N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide
N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide (PubChem CID 63294604) has the molecular formula C8H12F3NO2
and a molecular weight of 211.18 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide |
| PubChem CID | 63294604 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)NCC(O)C1CC1 |
| InChI | InChI=1S/C8H12F3NO2/c9-8(10,11)3-7(14)12-4-6(13)5-1-2-5/h5-6,13H,1-4H2,(H,12,14) |
| InChIKey | USJHFKIWLOJJPL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide (CID 63294604) is N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide is O=C(CC(F)(F)F)NCC(O)C1CC1.
What is the InChIKey of N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide?
The InChIKey is USJHFKIWLOJJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO2/c9-8(10,11)3-7(14)12-4-6(13)5-1-2-5/h5-6,13H,1-4H2,(H,12,14).
What are the key properties of N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide?
N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide has a molecular weight of 211.18 g/mol, XLogP of 0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclopropyl-2-hydroxyethyl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 63294604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).