About Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl-
Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl- (PubChem CID 6329488) has the molecular formula C6H18NSi3
and a molecular weight of 188.47 g/mol.
Molecular Properties
| Compound Name | Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl- |
| PubChem CID | 6329488 |
| Molecular Formula | C6H18NSi3 |
| Molecular Weight | 188.47 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | — |
| SMILES | C[Si](C)N([Si](C)C)[Si](C)C |
| InChI | InChI=1S/C6H18NSi3/c1-8(2)7(9(3)4)10(5)6/h1-6H3 |
| InChIKey | JBAKYNJRLAJRNW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl-?
The IUPAC name of Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl- (CID 6329488) is not available.
What is the SMILES notation for Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl-?
The canonical SMILES for Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl- is C[Si](C)N([Si](C)C)[Si](C)C.
What is the InChIKey of Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl-?
The InChIKey is JBAKYNJRLAJRNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18NSi3/c1-8(2)7(9(3)4)10(5)6/h1-6H3.
What are the key properties of Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl-?
Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl- has a molecular weight of 188.47 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Silanamine, N,N-bis(dimethylsilyl)-1,1-dimethyl- is sourced from PubChem (CID 6329488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).