C14H20N4O2S — CID 63295569
4-[(1-methylimidazol-2-yl)methylamino]-N-propylbenzenesulfonamide (PubChem CID 63295569) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 4-[(1-methylimidazol-2-yl)methylamino]-N-propylbenzenesulfonamide.
| Compound Name | 4-[(1-methylimidazol-2-yl)methylamino]-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 63295569 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-[(1-methylimidazol-2-yl)methylamino]-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc(NCc2nccn2C)cc1 |
| InChI | InChI=1S/C14H20N4O2S/c1-3-8-17-21(19,20)13-6-4-12(5-7-13)16-11-14-15-9-10-18(14)2/h4-7,9-10,16-17H,3,8,11H2,1-2H3 |
| InChIKey | DEJGHGXZKPRHPB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |