About 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide
2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide (PubChem CID 63296562) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide |
| PubChem CID | 63296562 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide |
| SMILES | CNC(=O)CNC1=NCC(C2CC2)S1 |
| InChI | InChI=1S/C9H15N3OS/c1-10-8(13)5-12-9-11-4-7(14-9)6-2-3-6/h6-7H,2-5H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | LTGVLHRNVVMXSQ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide?
The IUPAC name of 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide (CID 63296562) is 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide.
What is the SMILES notation for 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide?
The canonical SMILES for 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide is CNC(=O)CNC1=NCC(C2CC2)S1.
What is the InChIKey of 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide?
The InChIKey is LTGVLHRNVVMXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS/c1-10-8(13)5-12-9-11-4-7(14-9)6-2-3-6/h6-7H,2-5H2,1H3,(H,10,13)(H,11,12).
What are the key properties of 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide?
2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide has a molecular weight of 213.31 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-cyclopropyl-4,5-dihydro-1,3-thiazol-2-yl)amino]-N-methylacetamide is sourced from PubChem (CID 63296562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).