C14H20N2O2 — CID 63297211
2-amino-N-(2-cyclopropyl-2-hydroxyethyl)-3-phenylpropanamide (PubChem CID 63297211) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-amino-N-(2-cyclopropyl-2-hydroxyethyl)-3-phenylpropanamide.
| Compound Name | 2-amino-N-(2-cyclopropyl-2-hydroxyethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 63297211 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-amino-N-(2-cyclopropyl-2-hydroxyethyl)-3-phenylpropanamide |
| SMILES | NC(Cc1ccccc1)C(=O)NCC(O)C1CC1 |
| InChI | InChI=1S/C14H20N2O2/c15-12(8-10-4-2-1-3-5-10)14(18)16-9-13(17)11-6-7-11/h1-5,11-13,17H,6-9,15H2,(H,16,18) |
| InChIKey | SKZCMMIWIJWBLR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |