C11H20N2O3S — CID 63299474
N-ethyl-1,1-dioxo-N-pyrrolidin-3-ylthiolane-3-carboxamide (PubChem CID 63299474) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is N-ethyl-1,1-dioxo-N-pyrrolidin-3-ylthiolane-3-carboxamide.
| Compound Name | N-ethyl-1,1-dioxo-N-pyrrolidin-3-ylthiolane-3-carboxamide |
|---|---|
| PubChem CID | 63299474 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-ethyl-1,1-dioxo-N-pyrrolidin-3-ylthiolane-3-carboxamide |
| SMILES | CCN(C(=O)C1CCS(=O)(=O)C1)C1CCNC1 |
| InChI | InChI=1S/C11H20N2O3S/c1-2-13(10-3-5-12-7-10)11(14)9-4-6-17(15,16)8-9/h9-10,12H,2-8H2,1H3 |
| InChIKey | OCZLBRYKBJYKST-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |