C10H26O6Si5 — CID 6329970
1,3,5,7,9-Pentaethyl-1-hydroxycyclopentasiloxane (PubChem CID 6329970) has the molecular formula C10H26O6Si5 and a molecular weight of 382.74 g/mol.
| Compound Name | 1,3,5,7,9-Pentaethyl-1-hydroxycyclopentasiloxane |
|---|---|
| PubChem CID | 6329970 |
| Molecular Formula | C10H26O6Si5 |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | — |
| SMILES | CC[Si]1O[Si](CC)O[Si](CC)O[Si](O)(CC)O[Si](CC)O1 |
| InChI | InChI=1S/C10H26O6Si5/c1-6-17-12-18(7-2)14-20(9-4)16-21(11,10-5)15-19(8-3)13-17/h11H,6-10H2,1-5H3 |
| InChIKey | USFOMEPAKPECJH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|