C11H28O6Si5 — CID 6329992
1,3,5,7,9-Pentaethyl-1-methoxycyclopentasiloxane (PubChem CID 6329992) has the molecular formula C11H28O6Si5 and a molecular weight of 396.77 g/mol.
| Compound Name | 1,3,5,7,9-Pentaethyl-1-methoxycyclopentasiloxane |
|---|---|
| PubChem CID | 6329992 |
| Molecular Formula | C11H28O6Si5 |
| Molecular Weight | 396.77 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | — |
| SMILES | CC[Si]1O[Si](CC)O[Si](CC)O[Si](CC)(OC)O[Si](CC)O1 |
| InChI | InChI=1S/C11H28O6Si5/c1-7-18-13-19(8-2)15-21(10-4)17-22(11-5,12-6)16-20(9-3)14-18/h7-11H2,1-6H3 |
| InChIKey | UTZLPEISNGHMHV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|